Admin Table of Contents
What is another name for Cyclopropane?
Isopropylcyclopropane
Cyclopropane, (1-methylethyl)-
| PubChem CID | 137995 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C6H12 |
| Synonyms | Isopropylcyclopropane Cyclopropane, (1-methylethyl)- 3638-35-5 Propane, 2-cyclopropyl- ISO-PROPYLCYCLOPROPANE More… |
What is the structure of Cyclopropanol?
C3H6O
Cyclopropanol/Formula
What is the name of C3H6O?
| IUPAC Name | propan-2-one |
|---|---|
| Alternative Names | 2-propanone propanone Dimethyl ketone |
| Molecular Formula | C3H6O |
| Molar Mass | 58.08 g/mol |
| InChI | InChI=1S/C3H6O/c1-3(2)4/h1-2H3 |
What is the formula of Cyclopropene?
C3H4
Cyclopropene/Formula
CHEBI:51205 – cyclopropene Cyclopropene is an organic compound with the formula C3H4. It is the simplest cycloalkene.
What type of alcohol is Cyclopropanol?
Cyclopropanol is an organic compound with the chemical formula C3H6O. It contains a cyclopropyl group with a hydroxyl group attached to it….Cyclopropanol.
| Names | |
|---|---|
| Preferred IUPAC name Cyclopropanol | |
| Other names Cyclopropyl alcohol, Hydroxycyclopropane | |
| Identifiers | |
| CAS Number | 16545-68-9 |
Is cyclopropane an alkene?
The highly strained nature of cyclopropane compounds makes them very reactive and interesting synthetic targets. One common method of cyclopropane synthesis is the reaction of carbenes with the double bond in alkenes or cycloalkenes.
What is the name of c3h30?
allenolate | C3H3O | ChemSpider.
What type of hydrocarbon is c3h6?
Cyclopropane is a cycloalkane composed of three carbon atoms to form a ring. It has a role as an inhalation anaesthetic. It is a cycloalkane and a member of cyclopropanes.
What is the Iupac name of c2h4o2?
Acetic acid
Acetic acid/IUPAC ID
What is a cyclopropene?
Cyclopropene is an organic compound with the formula C3H4. It is the simplest cycloalkene. Because the ring is highly strained, cyclopropene is difficult to prepare and highly reactive.
Is Cyclopropanol polar?
Cyclopropane is a non-polar hydrocarbon.
What is the chemical formula for cyclopropanol?
Cyclopropanol is an organic compound with the chemical formula C 3 H 6 O. It contains a cyclopropyl group with a hydroxyl group attached to it. The compound is highly unstable due to the three-membered ring, and is susceptible to reactions that open the ring. It is highly prone to rearrangement,…
What is cyclopropyl used for in biology?
The chemical is also useful as a reagent to introduce a cyclopropyl group into ester, sulfate, and amine linkages. The resulting cyclopropyl-containing compounds have been used in investigations of potential antiviral drugs and of modulators of protein trafficking.
What is the name of the compound with formula C3H6O?
Cyclopropanol is an organic compound with the chemical formula C 3H 6O. It contains a cyclopropyl group with a hydroxyl group attached to it. The compound is highly unstable due to the three-membered ring, and is susceptible to reactions that open the ring.
What is the IUPAC name for Hexylresorcinol?
Hexylresorcinol is listed as an active ingredient in some mouthwashes and throat lozenges. The IUPAC name for hexylresorcinol is 4-hexyl-3-hydroxyphenol. Which of the following is its structure?