What compound is nac2h3o2?

What compound is nac2h3o2?

Sodium acetate
Sodium acetate/IUPAC ID

What type of compound is hch3co2?

ethanoic acid
acetic acid (CH3COOH), also called ethanoic acid, the most important of the carboxylic acids. A dilute (approximately 5 percent by volume) solution of acetic acid produced by fermentation and oxidation of natural carbohydrates is called vinegar; a salt, ester, or acylal of acetic acid is called acetate.

Is HC2H3O2 a molecular compound?

Acetic acid
Acetic acid/IUPAC ID

What is the conjugate base of HC2H3O2?

The conjugate base of acetic acid is the acetate anion (the parent acid less a proton, H+ ), hence H3C−C(=O)O− . The conjugate acid of OH2 is water plus a proton, i.e. an hydronium ion, H3O+ .

Is HC2H3O2 an ionic compound?

What is the formula for hc2h3o2?

The Ka of HC2H3O2 is found by calculating the concentrations of the reactants and products when the solution ionizes and then dividing the concentrations of the products multiplied together over the concentration of the reactant. For HC2H3O2, the formula for Ka is Ka = [H3O+][C2H3O2]/[HC2H3O2].

Is hc2h3o2 a strong or weak electrolyte?

HC2H3O2 is not a strong electrolyte. HC2H3O2 stands for acetic acid, which is a monoprotic acid. Since it is a weak acid, HC2H3O2 is considered a weak electrolyte. Acetic acid does not disintegrate wholly in water to form anions and cations, which are negatively and positively charged particles.

What is the correct name for this compound H2SO3?

Petropedia explains Sulfurous Acid (H2SO3) When sulfur dioxide gas is dissolved in water, the water becomes acidic in nature and the solution is called sulfurous acid. The compound is only formed in an aqueous solution and cannot be isolated in its pure form.

Is hc2h3o2 an acid or a base?

HC2H3O2 is a weak acid. It has an acid disassociation constant or Ka value of 1.74 times 10 to the power of minus 5, indicating that it ionizes poorly.